| Pack Size | Qty | Lead Time | Price | Quantity |
Lot Number
CAS #
*This document is like a lab demo—an example Certificate of Analysis (COA) that showcases what a COA looks like but may not match the latest batch in all its glory. Think of it as a chemistry experiment: close, but not quite the final reaction!
Share
Total BLR Stock
:
Bulk Quote| IUPAC name | N,N-dimethylacetamide |
| canonical smiles | CC(=O)N(C)C |
| inchi | InChI=1S/C4H9NO/c1-4(6)5(2)3/h1-3H3 |
| inchi key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| molecular formula | C4H9NO |
| synonyms | |
| Compound Description |
| Molecular Weight: | 87.12 g/mol |
| XLogP3: | -0.8 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptor Count: | 1 |
| Rotatable Bond Count: | 0 |
| Exact Mass: | 87.068413911 g/mol |
| Monoisotopic Mass: | 87.068413911 g/mol |
| Topological Polar Surface Area: | 20.3 Ų |
| Heavy Atom Count: | 6 |
| Formal Charge: | 0 |
| Complexity: | 58.6 |
| Isotope Atom Count: | 0 |
| Defined Atom Stereocenter Count: | 0 |
| Undefined Atom Stereocenter Count: | 0 |
| Defined Bond Stereocenter Count: | 0 |
| Undefined Bond Stereocenter Count: | 0 |
| Covalently-Bonded Unit Count: | 1 |
| Compound Is Canonicalized: | Yes |
| Related Compounds |
| hazard signal | Danger |
| hazard classes and categories | |
| precautionary statement codes | P203, P261, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P317, P318, P321, P337+P317, P362+P364, P405, and P501 |
| hazard statements | |
| hazards summary | Toxic hepatitis has been reported in workers after inhalation and dermal exposure. DMAC is fetotoxic and teratogenic when administered at high doses to rabbits and rats. NOAEL = 25 ppm for hepatic and renal toxicity in rats and mice. Humans exposed to high doses may experience mental confusion. A skin and eye irritant. Inhalation of high concentrations may cause liver and CNS effects. In a study of 440 new elastone fiber workers, 28 cases with elevated liver enzymes were detected in a 31 month period from 2002 to 2004. Using the BEI of 30 mg/g creatinine as a cutoff, the incidence of hepatic injury was about 7 times greater in the high exposure group. |
| symptoms | irritation skin. jaundice, liver damage. depression, drowsiness, hallucinations, delusions |
| carcinogen classification | IARC Carcinogenic Agent: N,N-Dimethylacetamide |
| carcinogen classification | IARC Carcinogenic Classes: Group 2B: Possibly carcinogenic to humans |
| carcinogen classification | IARC Monographs: Volume 123: Some Nitrobenzenes and Other Industrial Chemicals |
