| IUPAC name | N-(3-chloro-4-methylphenyl)-4-methylthiadiazole-5-carboxamide |
| inchi | InChI=1S/C11H10ClN3OS/c1-6-3-4-8(5-9(6)12)13-11(16)10-7(2)14-15-17-10/h3-5H,1-2H3,(H,13,16) |
| inchi key | VJQYLJSMBWXGDV-UHFFFAOYSA-N |
| molecular formula | C11H10ClN3OS |
| synonyms | Tiadinil223580-51-6N-(3-chloro-4-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamideSaixianjunanTiadinil [ISO] |
| Compound Description | Tiadinil is a monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-methyl-1,2,3-thiadiazole-5-carboxylic acid with the amino group of 3-chloro-4-methylaniline. It is a fungicide used particularly for the control of fungal diseases in rice. It has a role as an antifungal agrochemical. It is a monocarboxylic acid amide, a member of monochlorobenzenes, a member of thiadiazoles, an organosulfur compound and an anilide fungicide. |
