| IUPAC name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| canonical smiles | C1CN(CCN1CCO)CCS(=O)(=O)O |
| inchi | InChI=1S/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14) |
| inchi key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| molecular formula | C8H18N2O4S |
| synonyms | HEPES7365-45-92-(4-(2-Hydroxyethyl)piperazin-1-yl)ethanesulfonic acid4-(2-Hydroxyethyl)-1-piperazineethanesulfonic acid2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| Compound Description | 2-[4-piperazin-1-yl]ethanesulfonic acid is a HEPES that is ethanesulfonic acid in which one of the methyl hydrogens is replaced by a 4-piperazin-1-yl group. A Good's buffer substance, pKa = 7.55 at 20 ℃. It is a HEPES and an organosulfonic acid. It is a conjugate acid of a 2-[4-piperazin-1-yl]ethanesulfonate. It is a tautomer of a 2-[4-piperazin-4-ium-1-yl]ethanesulfonate.Hydroxyethylpiperazine Ethane Sulfonic Acid is a zwitterionic biological buffer used in cell culture to maintain physiological pH. It is less affected by changes in carbon dioxide concentrations than bicarbonate buffers.A dipolar ionic buffer. |
