| IUPAC name | (2R,3S,4R,5R)-2-fluoro-3,4,5,6-tetrahydroxyhexanal |
| inchi | InChI=1S/C6H11FO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2H2/t3-,4+,5+,6+/m0/s1 |
| inchi key | AOYNUTHNTBLRMT-SLPGGIOYSA-N |
| molecular formula | C6H11FO5 |
| synonyms | 29702-43-02-Deoxy-2-fluoro-D-glucose2-Fluoro-2-deoxy-D-glucoseFludeoxyglucose(2R,3S,4R,5R)-2-fluoro-3,4,5,6-tetrahydroxyhexanal |
| Compound Description | 2-deoxy-2-fluoro-aldehydo-D-glucose is a 2-deoxy-2-fluoro-D-glucose and an aldehyde. It is functionally related to an aldehydo-D-glucose.Fludeoxyglucose is under investigation in clinical trial NCT03262389 .The compound is given by intravenous injection to do POSITRON-EMISSION TOMOGRAPHY for the assessment of cerebral and myocardial glucose metabolism in various physiological or pathological states including stroke and myocardial ischemia. It is also employed for the detection of malignant tumors including those of the brain, liver, and thyroid gland. |
