| Pack Size | Qty | Lead Time | Price | Quantity |
Lot Number
CAS #
*This document is like a lab demo—an example Certificate of Analysis (COA) that showcases what a COA looks like but may not match the latest batch in all its glory. Think of it as a chemistry experiment: close, but not quite the final reaction!
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| canonical smiles | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)O)N |
| inchi | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
| inchi key | OIRDTQYFTABQOQ-KQYNXXCUSA-N |
| molecular formula | C10H13N5O4 |
| synonyms | |
| Compound Description |
| Molecular Weight: | 267.24 g/mol |
| XLogP3: | -1.1 |
| Hydrogen Bond Donor Count: | 4 |
| Hydrogen Bond Acceptor Count: | 8 |
| Rotatable Bond Count: | 2 |
| Exact Mass: | 267.09675391 g/mol |
| Monoisotopic Mass: | 267.09675391 g/mol |
| Topological Polar Surface Area: | 140 Ų |
| Heavy Atom Count: | 19 |
| Formal Charge: | 0 |
| Complexity: | 335 |
| Isotope Atom Count: | 0 |
| Defined Atom Stereocenter Count: | 4 |
| Undefined Atom Stereocenter Count: | 0 |
| Defined Bond Stereocenter Count: | 0 |
| Undefined Bond Stereocenter Count: | 0 |
| Covalently-Bonded Unit Count: | 1 |
| Compound Is Canonicalized: | Yes |
| Related Compounds |
| hazard signal | Warning |
| hazard classes and categories | |
| precautionary statement codes | P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 |
| hazard statements |
| toxicity summary | Adenosine slows conduction time through the AV node and can interrupt the reentry pathways through the AV node, resulting in the restoration of normal sinus rhythm in patients with paroxysmal supraventricular tachycardia , including PSVT associated with Wolff-Parkinson-White Syndrome. This effect may be mediated through the drug's activation of cell-surface A<sub>1</sub> and A<sub>2</sub> adenosine receptors. Adenosine also inhibits the slow inward calcium current and activation of adenylate cyclase in smooth muscle cells, thereby causing relaxation of vascular smooth muscle. By increasing blood flow in normal coronary arteries with little or no increase in stenotic arteries , adenosine produces a relative difference in thallous chloride TI 201 uptake in myocardium supplied by normal verus stenotic coronary arteries. |
| symptoms | |
| health effects | Chronically high levels of adeonsine are associated with Adenosine Deaminase Deficiency. |
| carcinogen classification | default_key: No indication of carcinogenicity to humans . |
