| IUPAC name | sodium;(2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| canonical smiles | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)[O-])C.[Na+] |
| inchi | InChI=1S/C16H19N3O4S.Na/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8;/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23);/q;+1/p-1/t9-,10-,11+,14-;/m1./s1 |
| inchi key | KLOHDWPABZXLGI-YWUHCJSESA-M |
| molecular formula | C16H18N3NaO4S |
| synonyms | 200-708-169-52-3Ampicillin sodiumAmpicillin sodium saltSodium ampicillin |
| Compound Description | Ampicillin sodium is an organic sodium salt. It contains an ampicillin.Ampicillin Sodium is the sodium salt form of ampicillin, a broad-spectrum semisynthetic derivative of aminopenicillin. Ampicillin sodium inhibits bacterial cell wall synthesis by binding to penicillin binding proteins, thereby inhibiting peptidoglycan synthesis, a critical component of the bacterial cell wall.Semi-synthetic derivative of penicillin that functions as an orally active broad-spectrum antibiotic.See also: Ampicillin ; Ampicillin sodium; sulbactam sodium . |