| IUPAC name | (1Z,5Z)-cycloocta-1,5-diene;nickel |
| canonical smiles | C1CC=CCCC=C1.C1CC=CCCC=C1.[Ni] |
| inchi | InChI=1S/2C8H12.Ni/c2*1-2-4-6-8-7-5-3-1;/h2*1-2,7-8H,3-6H2;/b2*2-1-,8-7-; |
| inchi key | JRTIUDXYIUKIIE-KZUMESAESA-N |
| molecular formula | C16H24Ni |
| synonyms | Bis(1,5-cyclooctadiene)nickel(0)Bis(1,5-cyclooctadiene)nickel1295-35-8Ni(COD)2Bis(cyclooctadiene)nickel(0) |
| Compound Description | Bisnickel appears as yellow crystals or yellowish green solid. Bisnickel is a chemical compound of nickel. It is a common source of Ni in chemical synthesis. Nickel is a chemical compound with the atomic number 28. It is found abundantly in nature in laterite ore minerals, such as limonite, garnierite, and pentlandite. Nickel has a biological role and is found in certain enzymes, including urease, hydrogenase, methylcoenzyme M reductase, and carbon monoxide dehydrogenase. |
