| IUPAC name | pentadecanoic acid |
| canonical smiles | CCCCCCCCCCCCCCC(=O)O |
| inchi | InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) |
| inchi key | WQEPLUUGTLDZJY-UHFFFAOYSA-N |
| molecular formula | C15H30O2 |
| synonyms | PENTADECANOIC ACID1002-84-2Pentadecylic acidn-Pentadecanoic acidPentadecyclic acid |
| Compound Description | Pentadecanoic acid is a straight-chain saturated fatty acid containing fifteen-carbon atoms. It has a role as a plant metabolite, a food component, a Daphnia magna metabolite, a human blood serum metabolite and an algal metabolite. It is a long-chain fatty acid and a straight-chain saturated fatty acid. It is a conjugate acid of a pentadecanoate.Pentadecanoic acid is a natural product found in Hoya crassipes, Hoya pseudolanceolata, and other organisms with data available.Pentadecylic Acid is a saturated fatty acid with a 15-carbon backbone. Pentadecylic acid is not normally synthesized by animals, but is found in trace amounts in dairy products. |
